Systematic / IUPAC Name: Butanedioic acid
ID: Reference1395
Other Names:
1,2-Ethanedicarboxylic acid;
1,4-Butanedioic acid;
Ethanedicarboxylic acid;
Amber acid;
Katasuccin
; more
Formula: C4H6O4
Class: Endogenous Metabolites Industrial Chemicals
Succinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 150 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 3:00:36 PM |
| InChI | InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
| InChI Key | KDYFGRWQOYBRFD-UHFFFAOYSA-N |
| Canonical SMILES | C(CC(=O)O)C(=O)O |
| CAS | 110156 |
| Splash | |
| Other Names |
1,2-Ethanedicarboxylic acid; 1,4-Butanedioic acid; Ethanedicarboxylic acid; Amber acid; Katasuccin; Dihydrofumaric acid; Wormwood acid |
| ChemSpider | 1078 |
| Wikipedia | Succinic acid |
| ChEBI | CHEBI:15741 |
| HMDb | HMDB00254 |
| KEGG | C00042; D00635; D00676; D00794; D01269; D01455; D02327; D02670; D02734; D03412 |
| PubChem | 1110 |
| ChEMBL | CHEMBL576 |
| ChemIDPlus | 000110156; 000141004; 000150903; 000562107; 000749484; 001175606; 001252568; 003267763; 018801268; 017185261 |
| LipidsMAPs | LMFA01170043 |