Systematic / IUPAC Name: Methyl 2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate
ID: Reference13955
Other Names:
Methyl jasmonate;
AA-4732
Formula: C13H20O3
Class: Endogenous Metabolites
(-)-Methyl jasmonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2684 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/26/2026 3:29:29 PM |
| InChI | InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4-/t10-,11-/m1/s1 |
| InChI Key | GEWDNTWNSAZUDX-WQMVXFAESA-N |
| Canonical SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CC(=O)OC |
| CAS | |
| Splash | |
| Other Names |
Methyl jasmonate; AA-4732 |
| ChEMBL | CHEMBL2139332 |
| KEGG | C11512 |
| ChEBI | CHEBI:15929 |
| PubChem | 5281929; 5281929 |
| HMDb | HMDB0036583 |
| ChemSpider | 4445210 |