Systematic / IUPAC Name: 5-Hexyloxolan-2-one
ID: Reference13956
Other Names: AA-4738
Formula: C10H18O2
Class: Endogenous Metabolites
γ-Decalactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1215 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/26/2026 3:27:42 PM |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h9H,2-8H2,1H3 |
| InChI Key | IFYYFLINQYPWGJ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCC1CCC(=O)O1 |
| CAS | |
| Splash | |
| Other Names | AA-4738 |
| ChemSpider | 12285 |
| PubChem | 12813; 12813 |
| Wikipedia | Gamma-Decalactone |
| HMDb | HMDB37217 |
| ChEMBL | CHEMBL365740 |
| ChEBI | CHEBI:145740 |