Systematic / IUPAC Name: 5-Heptyloxolan-2-one
ID: Reference13958
Other Names: AA-4745
Formula: C11H20O2
Class: Endogenous Metabolites
γ-Undecalactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1255 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/26/2026 2:08:58 PM |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3 |
| InChI Key | PHXATPHONSXBIL-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCC1CCC(=O)O1 |
| CAS | |
| Splash | |
| Other Names | AA-4745 |
| HMDb | HMDB0038311; HMDB38311 |
| ChemSpider | 7428 |
| ChEBI | CHEBI:89362 |
| ChEMBL | CHEMBL195827 |
| KEGG | C08571 |
| PubChem | 7714; 7714 |