Systematic / IUPAC Name: 2,3-Diethylpyrazine
ID: Reference13959
Other Names: AA-4754
Formula: C8H12N2
Class: Endogenous Metabolites
2,3-Diethylpyrazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 185 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/26/2026 2:07:29 PM |
| InChI | InChI=1S/C8H12N2/c1-3-7-8(4-2)10-6-5-9-7/h5-6H,3-4H2,1-2H3 |
| InChI Key | GZXXANJCCWGCSV-UHFFFAOYSA-N |
| Canonical SMILES | CCc1nccnc1CC |
| CAS | |
| Splash | |
| Other Names | AA-4754 |
| PubChem | 27458; 27458 |
| HMDb | HMDB41253 |
| ChemSpider | 25552 |
| ChEMBL | CHEMBL327303 |