Systematic / IUPAC Name: 1-(10H-Phenothiazin-2-yl)ethanone
ID: Reference13962
Other Names: AA-3651
Formula: C14H11NOS
Class: Endogenous Metabolites
2-Acetylphenothiazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1184 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/26/2026 1:45:17 PM |
| InChI | InChI=1S/C14H11NOS/c1-9(16)10-6-7-14-12(8-10)15-11-4-2-3-5-13(11)17-14/h2-8,15H,1H3 |
| InChI Key | JWGBOHJGWOPYCL-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)c1ccc2c(c1)Nc1ccccc1S2 |
| CAS | |
| Splash | |
| Other Names | AA-3651 |
| PubChem | 81131; 81131 |
| ChEBI | CHEBI:92473 |
| ChemSpider | 73197 |
| ChEMBL | CHEMBL407734 |