Systematic / IUPAC Name: [(2R)-2-Butanoyloxy-3-carboxypropyl]-trimethylazanium
ID: Reference13965
Other Names: AA-2617
Formula: C11H22NO4 +
Class: Endogenous Metabolites
Butyrylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 330 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/26/2026 1:09:42 PM |
| InChI | InChI=1S/C11H21NO4/c1-5-6-11(15)16-9(7-10(13)14)8-12(2,3)4/h9H,5-8H2,1-4H3/p+1/t9-/m1/s1 |
| InChI Key | QWYFHHGCZUCMBN-SECBINFHSA-O |
| Canonical SMILES | CCCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2617 |