Systematic / IUPAC Name: (E)-4-(2,6,6-Trimethylcyclohexen-1-yl)but-3-en-2-one
ID: Reference13966
Other Names: AA-4800
Formula: C13H20O
Class: Endogenous Metabolites
β-Ionone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1650 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/1/2026 3:40:51 PM |
| InChI | InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8H,5-6,9H2,1-4H3/b8-7+ |
| InChI Key | PSQYTAPXSHCGMF-BQYQJAHWSA-N |
| Canonical SMILES | CC(=O)/C=C/C1=C(C)CCCC1(C)C |
| CAS | |
| Splash | |
| Other Names | AA-4800 |
| ChEMBL | CHEMBL3184146 |
| PubChem | 638014; 638014 |
| HMDb | HMDB0036565; HMDB0036565 |
| KEGG | C12287 |
| ChEBI | CHEBI:32325 |
| ChemSpider | 553581 |
| Wikipedia | beta-Ionone |