Systematic / IUPAC Name: (3S)-3-Methylhexanedioic acid
ID: Reference13971
Other Names: AA-4166
Formula: C7H12O4
Class: Endogenous Metabolites
(3S)-3-Methylhexanedioic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/1/2026 4:02:57 PM |
| InChI | InChI=1S/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChI Key | SYEOWUNSTUDKGM-YFKPBYRVSA-N |
| Canonical SMILES | C[C@@H](CCC(=O)O)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4166 |
| HMDb | HMDB0000555; HMDB0000555; HMDB0000555 |
| ChemSpider | 5367267 |
| PubChem | 6999745; 6999745 |