Systematic / IUPAC Name: 6-Methoxy-6-oxohexanoic acid
ID: Reference13976
Other Names: AA-4810
Formula: C7H12O4
Class: Endogenous Metabolites
Monomethyl adipate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 849 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/7/2026 8:47:56 AM |
| InChI | InChI=1S/C7H12O4/c1-11-7(10)5-3-2-4-6(8)9/h2-5H2,1H3,(H,8,9) |
| InChI Key | UOBSVARXACCLLH-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)CCCCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4810 |
| HMDb | HMDB0059722 |
| ChEMBL | CHEMBL3183809 |
| PubChem | 12328; 12328 |
| ChEBI | CHEBI:70855 |
| ChemSpider | 11823 |