Systematic / IUPAC Name: (7E,10E)-2,6,11,15-Tetramethylhexadeca-2,7,10,14-tetraen-6-ol
ID: Reference13977
Other Names: AA-4822
Formula: C20H34O
Class: Endogenous Metabolites
(E,E)-Geranyllinalool mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 335 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/7/2026 8:46:38 AM |
| InChI | InChI=1S/C20H34O/c1-17(2)11-9-14-19(5)13-7-8-15-20(6,21)16-10-12-18(3)4/h8,11-13,15,21H,7,9-10,14,16H2,1-6H3/b15-8+,19-13+ |
| InChI Key | SYWIUZCNOUKNSM-KHSZGTTOSA-N |
| Canonical SMILES | CC(C)=CCC/C(C)=C/C/C=C/C(C)(O)CCC=C(C)C |
| CAS | |
| Splash | |
| Other Names | AA-4822 |