Systematic / IUPAC Name: (3S,4S)-3,4-Bis[(3-hydroxyphenyl)methyl]oxolan-2-one
ID: Reference13978
Other Names: AA-2624
Formula: C18H18O4
Class: Endogenous Metabolites
Enterolactone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4199 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/6/2026 7:52:54 PM |
| InChI | InChI=1S/C18H18O4/c19-15-5-1-3-12(8-15)7-14-11-22-18(21)17(14)10-13-4-2-6-16(20)9-13/h1-6,8-9,14,17,19-20H,7,10-11H2/t14-,17+/m1/s1 |
| InChI Key | HVDGDHBAMCBBLR-PBHICJAKSA-N |
| Canonical SMILES | O=C1OC[C@@H](Cc2cccc(O)c2)[C@@H]1Cc1cccc(O)c1 |
| CAS | |
| Splash | |
| Other Names | AA-2624 |
| ChEBI | CHEBI:81555 |
| KEGG | C18165 |
| ChEMBL | CHEMBL2391150 |
| ChemSpider | 102727 |
| PubChem | 114739; 114739 |