Systematic / IUPAC Name: (3R)-3-[(5Z,8Z,11Z,14Z)-Icosa-5,8,11,14-tetraenoyl]oxy-4-(trimethylazaniumyl)butanoate
ID: Reference13979
Other Names: AA-2630
Formula: C27H46NO4 +
Class: Endogenous Metabolites
Arachidonoylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 105 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/6/2026 8:00:24 PM |
| InChI | InChI=1S/C27H45NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(31)32-25(23-26(29)30)24-28(2,3)4/h9-10,12-13,15-16,18-19,25H,5-8,11,14,17,20-24H2,1-4H3/b10-9-,13-12-,16-15-,19-18-/t25-/m1/s1 |
| InChI Key | RBFQHRALHSUPIA-JTPUQHSZSA-O |
| Canonical SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2630 |