Systematic / IUPAC Name: 3-Methylphenol
ID: Reference13980
Other Names: AA-4593
Formula: C7H8O
Class: Endogenous Metabolites
m-Cresol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 195 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/8/2026 8:55:54 AM |
| InChI | InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 |
| InChI Key | RLSSMJSEOOYNOY-UHFFFAOYSA-N |
| Canonical SMILES | Cc1cccc(O)c1 |
| CAS | |
| Splash | |
| Other Names | AA-4593 |
| PubChem | 342; 342 |
| ChEMBL | CHEMBL298312 |
| HMDb | HMDB0002048; HMDB0002048; HMDB0002048; HMDB0002048 |
| ChEBI | CHEBI:17231 |
| ChemSpider | More details; 21105871 |
| DrugBank | DB01776; DB01776 |
| KEGG | C01467 |
| Wikipedia | M-Cresol |