Systematic / IUPAC Name: Methyl 2-(4-tert-butylphenyl)acetate
ID: Reference13981
Other Names: AA4594
Formula: C13H18O2
Class: Endogenous Metabolites
Methyl p-tert-butylphenylacetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 620 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/8/2026 8:58:45 AM |
| InChI | InChI=1S/C13H18O2/c1-13(2,3)11-7-5-10(6-8-11)9-12(14)15-4/h5-8H,9H2,1-4H3 |
| InChI Key | HXVTYMWVMVKVTF-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)Cc1ccc(C(C)(C)C)cc1 |
| CAS | |
| Splash | |
| Other Names | AA4594 |
| PubChem | 605629 |
| ChemSpider | 526437 |
| HMDb | HMDB0036240 |