Systematic / IUPAC Name: 5-Methoxy-5-oxopentanoic acid
ID: Reference13985
Other Names:
Monomethyl glutaric acid;
AA-4629
Formula: C6H10O4
Class: Endogenous Metabolites
Monomethyl glutarate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 726 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/8/2026 11:14:40 AM |
| InChI | InChI=1S/C6H10O4/c1-10-6(9)4-2-3-5(7)8/h2-4H2,1H3,(H,7,8) |
| InChI Key | IBMRTYCHDPMBFN-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)CCCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
Monomethyl glutaric acid; AA-4629 |
| HMDb | HMDB0000858; HMDB0000858 |
| ChEBI | CHEBI:86396 |
| ChemSpider | 66550 |
| PubChem | 73917; 73917 |
| ChEMBL | CHEMBL1483438 |