Systematic / IUPAC Name: (4aR,5aS,8aR,13aS,15aS,15bR)-10,11-Dimethoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-H]quinolin-14-one
ID: Reference13987
Other Names: AA-3926
Formula: C23H26N2O4
Class: Endogenous Metabolites
Brucine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2992 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 9:58:45 AM |
| InChI | InChI=1S/C23H26N2O4/c1-27-16-8-14-15(9-17(16)28-2)25-20(26)10-18-21-13-7-19-23(14,22(21)25)4-5-24(19)11-12(13)3-6-29-18/h3,8-9,13,18-19,21-22H,4-7,10-11H2,1-2H3/t13-,18-,19-,21-,22-,23+/m0/s1 |
| InChI Key | RRKTZKIUPZVBMF-IBTVXLQLSA-N |
| Canonical SMILES | COc1cc2c(cc1OC)[C@@]13CCN4CC5=CCO[C@H]6CC(=O)N2[C@H]1[C@H]6[C@H]5C[C@H]43 |
| CAS | |
| Splash | |
| Other Names | AA-3926 |
| Wikipedia | Brucine |
| ChEBI | CHEBI:3193 |
| PubChem | 442021; 442021 |
| ChEMBL | CHEMBL501756 |
| ChemSpider | More details; 390579 |
| KEGG | C09084 |