Systematic / IUPAC Name: [(2R)-3-Carboxy-2-(2-methylpropanoyloxy)propyl]-trimethylazanium
ID: Reference13989
Other Names: AA-2637
Formula: C11H22NO4 +
Class: Endogenous Metabolites
Isobutyryl-L-carnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 584 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/10/2026 2:56:36 PM |
| InChI | InChI=1S/C11H21NO4/c1-8(2)11(15)16-9(6-10(13)14)7-12(3,4)5/h8-9H,6-7H2,1-5H3/p+1/t9-/m1/s1 |
| InChI Key | LRCNOZRCYBNMEP-SECBINFHSA-O |
| Canonical SMILES | CC(C)C(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2637 |