Systematic / IUPAC Name: [3-Carboxy-2-(3-methylbutanoyloxy)propyl]-trimethylazanium
ID: Reference13990
Other Names: AA-2638
Formula: C12H24NO4 +
Class: Endogenous Metabolites
Isovalerylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 590 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 9:55:50 AM |
| InChI | InChI=1S/C12H23NO4/c1-9(2)6-12(16)17-10(7-11(14)15)8-13(3,4)5/h9-10H,6-8H2,1-5H3/p+1 |
| InChI Key | IGQBPDJNUXPEMT-UHFFFAOYSA-O |
| Canonical SMILES | CC(C)CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2638 |