Systematic / IUPAC Name: (2R)-2-Amino-3-methylsulfanylpropanoic acid
ID: Reference13993
Other Names: AA-4051
Formula: C4H9NO2S
Class: Endogenous Metabolites
S-Methyl-L-cysteine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 83 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 9:41:49 AM |
| InChI | InChI=1S/C4H9NO2S/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChI Key | IDIDJDIHTAOVLG-VKHMYHEASA-N |
| Canonical SMILES | CSC[C@H](N)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-4051 |
| HMDb | HMDB0002108; HMDB0002108; HMDB02108 |
| ChemSpider | 22826 |
| ChEMBL | CHEMBL394875 |
| ChEBI | CHEBI:45658 |
| DrugBank | DB02216; DB02216 |
| PubChem | 7058174; 24417 |