Systematic / IUPAC Name: (2R)-2,7,8-Trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol
ID: Reference13998
Other Names: AA-2642
Formula: C28H42O2
Class: Steroids/Vitamins/Hormones Endogenous Metabolites Natural Products/Medicines
γ-Tocotrienol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 422 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 9:38:01 AM |
| InChI | InChI=1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15+/t28-/m1/s1 |
| InChI Key | OTXNTMVVOOBZCV-WAZJVIJMSA-N |
| Canonical SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)c(C)c(C)c2O1 |
| CAS | |
| Splash | |
| Other Names | AA-2642 |
| ChemSpider | 4445514 |
| HMDb | HMDB0012958 |
| PubChem | 5282349 |
| ChEMBL | CHEMBL120697 |
| KEGG | C14155 |
| ChEBI | CHEBI:33277 |