Systematic / IUPAC Name: (2S)-1,1-Dimethylpyrrolidin-1-ium-2-carboxylic acid
ID: Reference13999
Other Names: AA-2651
Formula: C7H14NO2 +
Class: Endogenous Metabolites
N,N-Dimethylproline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 145 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 9:36:19 AM |
| InChI | InChI=1S/C7H13NO2/c1-8(2)5-3-4-6(8)7(9)10/h6H,3-5H2,1-2H3/p+1/t6-/m0/s1 |
| InChI Key | CMUNUTVVOOHQPW-LURJTMIESA-O |
| Canonical SMILES | C[N+]1(C)CCC[C@H]1C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2651 |
| PubChem | 448301 |
| ChemSpider | 395141 |
| ChEBI | CHEBI:44813 |