Systematic / IUPAC Name: 2-Amino-3-prop-2-enylsulfanylpropanoic acid
ID: Reference14007
Other Names: AA-2759
Formula: C6H11NO2S
Class: Endogenous Metabolites
S-Allylcysteine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 150 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2026 11:46:38 AM |
| InChI | InChI=1S/C6H11NO2S/c1-2-3-10-4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9) |
| InChI Key | ZFAHNWWNDFHPOH-UHFFFAOYSA-N |
| Canonical SMILES | C=CCSCC(N)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2759 |
| ChemSpider | UCL-ABT-JRS-151; 88744 |
| ChEMBL | CHEMBL1592541 |
| HMDb | HMDB0034323 |
| KEGG | C16759 |
| PubChem | 25202793 |