Systematic / IUPAC Name: (7R,8S,9S,10R,13R,14S,17R)-7-Hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
ID: Reference14018
Other Names: AA-2768
Formula: C27H44O2
Class: Steroids/Vitamins/Hormones Endogenous Metabolites
7α-Hydroxy-4-cholesten-3-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2047 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/24/2026 3:59:53 PM |
| InChI | InChI=1S/C27H44O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h15,17-18,21-25,29H,6-14,16H2,1-5H3/t18-,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
| InChI Key | IOIZWEJGGCZDOL-RQDYSCIWSA-N |
| Canonical SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| CAS | |
| Splash | |
| Other Names | AA-2768 |
| LipidsMAPs | LMST04030123 |
| ChemSpider | 110306 |
| ChEBI | CHEBI:17899 |
| Wikipedia | 7?-Hydroxy-4-cholesten-3-one |
| KEGG | C05455 |
| PubChem | 123743 |
| ChEMBL | CHEMBL4285345 |
| HMDb | HMDB0001993; HMDB0001993; HMDB0001993 |