Systematic / IUPAC Name: (6R)-6-[(7R,8S,9S,10R,13R,14S,17R)-7-Hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid
ID: Reference14021
Other Names: AA-2772
Formula: C27H42O4
Class: Steroids/Vitamins/Hormones Endogenous Metabolites
7α-Hydroxy-3-oxo-4-cholestenoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3191 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 9:28:20 AM |
| InChI | InChI=1S/C27H42O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h14,16-17,20-24,29H,5-13,15H2,1-4H3,(H,30,31)/t16-,17?,20-,21+,22+,23-,24+,26+,27-/m1/s1 |
| InChI Key | SATGKQGFUDXGAX-MYWFJNCASA-N |
| Canonical SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2772 |
| ChemSpider | 2338765 |
| PubChem | 3081085 |
| KEGG | C17337 |
| HMDb | HMDB0012458 |
| ChEBI | CHEBI:83036 |