Systematic / IUPAC Name: (4R)-4-[(3R,5R,6R,7S,8S,9S,10R,13R,14S)-3,6,7-Trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
ID: Reference14024
Other Names: AA-2650
Formula: C24H40O5
Class: Steroids/Vitamins/Hormones Endogenous Metabolites
α-Hyocholic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2345 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 8:59:12 AM |
| InChI | InChI=1S/C24H40O5/c1-13(4-7-19(26)27)15-5-6-16-20-17(9-11-23(15,16)2)24(3)10-8-14(25)12-18(24)21(28)22(20)29/h13-18,20-22,25,28-29H,4-12H2,1-3H3,(H,26,27)/t13-,14-,15?,16+,17+,18+,20+,21-,22+,23-,24-/m1/s1 |
| InChI Key | DKPMWHFRUGMUKF-NNFRHCBVSA-N |
| Canonical SMILES | C[C@H](CCC(=O)O)C1CC[C@H]2[C@@H]3[C@H](O)[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| CAS | |
| Splash | |
| Other Names | AA-2650 |
| ChemSpider | 59651444 |
| PubChem | 131750324 |
| HMDb | HMDB0000760; HMDB0000760 |