Systematic / IUPAC Name: 2-[(3-Oxo-3-phenylpropyl)amino]acetic acid
ID: Reference14030
Other Names: AA-2667
Formula: C11H13NO3
Class: Endogenous Metabolites
3-Phenylpropionylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1257 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/21/2026 8:29:34 PM |
| InChI | InChI=1S/C11H13NO3/c13-10(6-7-12-8-11(14)15)9-4-2-1-3-5-9/h1-5,12H,6-8H2,(H,14,15) |
| InChI Key | XHSURMJJKAFELI-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)CNCCC(=O)c1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-2667 |