Systematic / IUPAC Name: [(2R)-3-Carboxy-2-(4-carboxybutanoyloxy)propyl]-trimethylazanium
ID: Reference14032
Other Names: AA-2838
Formula: C12H22NO6 +
Class: Endogenous Metabolites
Glutarylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 406 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2026 8:23:15 AM |
| InChI | InChI=1S/C12H21NO6/c1-13(2,3)8-9(7-11(16)17)19-12(18)6-4-5-10(14)15/h9H,4-8H2,1-3H3,(H-,14,15,16,17)/p+1/t9-/m1/s1 |
| InChI Key | NXJAXUYOQLTISD-SECBINFHSA-O |
| Canonical SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)CCCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2838 |
| HMDb | HMDB0013130; HMDB0013130 |
| ChEBI | CHEBI:82952 |
| PubChem | 71317118 |
| ChemSpider | 34448634 |