Systematic / IUPAC Name: (3S,7S,8S,9S,10R,13R,14S,17R)-10,13-Dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol
ID: Reference14033
Other Names: AA-2842
Formula: C27H46O2
Class: Steroids/Vitamins/Hormones Endogenous Metabolites
7α-Hydroxycholesterol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2026 8:26:57 AM |
| InChI | InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24-,25+,26+,27-/m1/s1 |
| InChI Key | OYXZMSRRJOYLLO-RVOWOUOISA-N |
| Canonical SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| CAS | |
| Splash | |
| Other Names | AA-2842 |
| LipidsMAPs | LMST01010013 |
| ChEBI | CHEBI:17500 |
| Wikipedia | 7-alpha-hydroxycholesterol |
| ChEMBL | CHEMBL497207 |
| ChemSpider | 96891 |
| KEGG | C03594 |
| PubChem | 107722 |