Systematic / IUPAC Name: [(2R)-3-Carboxy-2-[(E)-2-methylbut-2-enoyl]oxypropyl]-trimethylazanium
ID: Reference14036
Other Names: AA-2848
Formula: C12H22NO4 +
Class: Endogenous Metabolites
Tiglylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 288 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2026 8:35:08 AM |
| InChI | InChI=1S/C12H21NO4/c1-6-9(2)12(16)17-10(7-11(14)15)8-13(3,4)5/h6,10H,7-8H2,1-5H3/p+1/b9-6+/t10-/m1/s1 |
| InChI Key | WURBQCVBQNMUQT-OLKPEBQYSA-O |
| Canonical SMILES | C/C=C(\C)/C(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2848 |
| HMDb | HMDB0002366; HMDB0002366; HMDB0002366; HMDB0002366 |
| ChEBI | CHEBI:85520 |
| PubChem | 91825636 |
| ChemSpider | 34999729 |