Systematic / IUPAC Name: [(2S)-3-Carboxy-2-pentanoyloxypropyl]-trimethylazanium
ID: Reference14037
Other Names: AA-2849
Formula: C12H24NO4 +
Class: Endogenous Metabolites
Valeryl-L-carnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 295 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2026 8:37:40 AM |
| InChI | InChI=1S/C12H23NO4/c1-5-6-7-12(16)17-10(8-11(14)15)9-13(2,3)4/h10H,5-9H2,1-4H3/p+1/t10-/m0/s1 |
| InChI Key | VSNFQQXVMPSASB-JTQLQIEISA-O |
| Canonical SMILES | CCCCC(=O)O[C@@H](CC(=O)[O-])C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2849 |
| PubChem | 53481619 |
| HMDb | HMDB13128 |
| LipidsMAPs | LMFA07070111 |
| ChemSpider | 30776695 |