Systematic / IUPAC Name: [(2R)-3-Carboxy-2-(3-carboxypropanoyloxy)propyl]-trimethylazanium
ID: Reference14038
Other Names: AA-2850
Formula: C11H20NO6 +
Class: Endogenous Metabolites
Succinylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2026 8:49:38 AM |
| InChI | InChI=1S/C11H19NO6/c1-12(2,3)7-8(6-10(15)16)18-11(17)5-4-9(13)14/h8H,4-7H2,1-3H3,(H-,13,14,15,16)/p+1/t8-/m1/s1 |
| InChI Key | HAEVNYBCYZZDFL-MRVPVSSYSA-O |
| Canonical SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)CCC(=O)O |
| CAS | |
| Splash | |
| Other Names | AA-2850 |
| PubChem | 131802075 |
| ChemSpider | 62896353 |
| HMDb | HMDB0061717; HMDB0061717; HMDB0061717 |