Systematic / IUPAC Name: [(1S)-3-Carboxy-1-[(E)-oct-2-enoyl]oxypropyl]-trimethylazanium
ID: Reference14039
Other Names: AA-2851
Formula: C15H28NO4 +
Class: Endogenous Metabolites
Octenoyl-L-carnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 330 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2026 8:53:33 AM |
| InChI | InChI=1S/C15H27NO4/c1-5-6-7-8-9-10-15(19)20-13(16(2,3)4)11-12-14(17)18/h9-10,13H,5-8,11-12H2,1-4H3/p+1/b10-9+/t13-/m0/s1 |
| InChI Key | YMIVWYONPRZBEJ-LXKVQUBZSA-O |
| Canonical SMILES | CCCCC/C=C/C(=O)O[C@@H](CCC(=O)O)[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2851 |