Systematic / IUPAC Name: [3-Carboxy-2-(4-carboxy-3-methylbutanoyl)oxypropyl]-trimethylazanium
ID: Reference14040
Other Names: AA-2853
Formula: C13H24NO6 +
Class: Endogenous Metabolites
Methylglutaryl-L-carnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 410 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/20/2026 8:58:44 AM |
| InChI | InChI=1S/C13H23NO6/c1-9(5-11(15)16)6-13(19)20-10(7-12(17)18)8-14(2,3)4/h9-10H,5-8H2,1-4H3,(H-,15,16,17,18)/p+1 |
| InChI Key | HFCPFJNSBPQJDP-UHFFFAOYSA-O |
| Canonical SMILES | CC(CC(=O)O)CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2853 |