Systematic / IUPAC Name: (4S,5R)-4,5-Dihydroxy-2-oxo-6-phosphonooxyhexanoic acid
ID: Reference14043
Other Names: AA-2695
Formula: C6H11O9P
Class: Endogenous Metabolites
2-Keto-3-deoxy-6-phosphogluconic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 497 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/21/2026 8:27:22 PM |
| InChI | InChI=1S/C6H11O9P/c7-3(1-4(8)6(10)11)5(9)2-15-16(12,13)14/h3,5,7,9H,1-2H2,(H,10,11)(H2,12,13,14)/t3-,5+/m0/s1 |
| InChI Key | OVPRPPOVAXRCED-WVZVXSGGSA-N |
| Canonical SMILES | O=C(O)C(=O)C[C@H](O)[C@H](O)COP(=O)(O)O |
| CAS | |
| Splash | |
| Other Names | AA-2695 |
| ChEBI | CHEBI:15925 |
| HMDb | HMDB01376 |
| KEGG | C04442 |
| ChemSpider | 2338483 |
| PubChem | 3080745 |
| ChEMBL | CHEMBL1162150 |