Systematic / IUPAC Name: (3S,8S,9S,10R,13R,14S,17R)-10,13-Dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
ID: Reference14044
Other Names: AA-2776
Formula: C27H46O
Class: Therapeutics/Prescription Drugs Steroids/Vitamins/Hormones Endogenous Metabolites Excipients/Additives/Colorants Personal Care Products/Cosmetics
Cholesterol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 170 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/21/2026 5:56:53 PM |
| InChI | InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChI Key | HVYWMOMLDIMFJA-DPAQBDIFSA-N |
| Canonical SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| CAS | |
| Splash | |
| Other Names | AA-2776 |
| ChEBI | CHEBI:16113 |
| HMDb | HMDB62453 |
| ChEMBL | CHEMBL112570 |
| KEGG | C00187 |
| LipidsMAPs | LMST01010001 |
| DrugBank | DB04540 |
| Wikipedia | Cholesterol |
| ChemSpider | More details; 5775 |
| PubChem | 5997; 5997 |