Systematic / IUPAC Name: (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,12-Dihydroxy-10,13-dimethyl-7-oxo-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid
ID: Reference14048
Other Names: AA-2790
Formula: C24H38O5
Class: Steroids/Vitamins/Hormones Endogenous Metabolites
7-Ketodeoxycholic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2156 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/21/2026 6:01:17 PM |
| InChI | InChI=1S/C24H38O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-18,20,22,25,27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,15-,16-,17+,18+,20+,22+,23+,24-/m1/s1 |
| InChI Key | RHCPKKNRWFXMAT-RRWYKFPJSA-N |
| Canonical SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3C(=O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| CAS | |
| Splash | |
| Other Names | AA-2790 |
| LipidsMAPs | LMST04010184 |
| ChEBI | CHEBI:16390 |
| HMDb | HMDB0000391; HMDB00391 |
| ChEMBL | CHEMBL3392000 |
| PubChem | 188292 |
| ChemSpider | 163659 |