Systematic / IUPAC Name: [(2R)-3-Carboxy-2-(3-hydroxybutanoyloxy)propyl]-trimethylazanium
ID: Reference14070
Other Names: AA-2811
Formula: C11H22NO5 +
Class: Endogenous Metabolites
(R)-3-Hydroxybutyrylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 302 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/25/2026 3:01:53 PM |
| InChI | InChI=1S/C11H21NO5/c1-8(13)5-11(16)17-9(6-10(14)15)7-12(2,3)4/h8-9,13H,5-7H2,1-4H3/p+1/t8?,9-/m1/s1 |
| InChI Key | UEFRDQSMQXDWTO-YGPZHTELSA-O |
| Canonical SMILES | CC(O)CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2811 |
| ChemSpider | 34999533 |
| ChEBI | CHEBI:84842 |
| PubChem | 90659885 |
| HMDb | HMDB62735 |