Systematic / IUPAC Name: [4-(6-Aminopurin-9-yl)-2-hydroxy-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol
ID: Reference14077
Other Names:
4-(6-Amino-9H-purin-9-yl)-2-hydroxy-6-(hydroxymethyl)tetrahydrofuro[3,4-d][1,3,2]dioxaphosphole 2-oxide;
AA-3137
Formula: C10H12N5O6P
Class: Endogenous Metabolites
Adenosine 2',3'-cyclic phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1089 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/2/2026 4:10:37 PM |
| InChI | InChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7-6(4(1-16)19-10)20-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13) |
| InChI Key | KMYWVDDIPVNLME-UHFFFAOYSA-N |
| Canonical SMILES | Nc1ncnc2c1ncn2C1OC(CO)C2OP(=O)(O)OC21 |
| CAS | |
| Splash | |
| Other Names |
4-(6-Amino-9H-purin-9-yl)-2-hydroxy-6-(hydroxymethyl)tetrahydrofuro[3,4-d][1,3,2]dioxaphosphole 2-oxide; AA-3137 |