Systematic / IUPAC Name: 1-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione
ID: Reference1408
Other Names:
Uracil riboside;
Uracil, 1-β-D-ribofuranosyl-;
1-β-δ-Ribofuranosyl-2,4(1H,3H)-pyrimidinedione
Formula: C9H12N2O6
Class: Endogenous Metabolites
Uridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 175 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 2:47:10 PM |
| InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 |
| InChI Key | DRTQHJPVMGBUCF-XVFCMESISA-N |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
| CAS | 58968 |
| Splash | |
| Other Names |
Uracil riboside; Uracil, 1-β-D-ribofuranosyl-; 1-β-δ-Ribofuranosyl-2,4(1H,3H)-pyrimidinedione |
| Wikipedia | Uridine |
| ChEBI | CHEBI:16704 |
| HMDb | HMDB00296 |
| ChemIDPlus | 000058968; 021231594 |
| ChemSpider | 5807 |
| PubChem | 6029 |
| ChEMBL | CHEMBL100259 |
| KEGG | C00299 |