Systematic / IUPAC Name: (2S,3S,4S,5R,6R)-6-({[(2R,3S,4R,5R)-5-(2,4-Dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl}oxy-hydroxyphosphoryl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid
ID: Reference1411
Other Names:
UDP-α-δ-glucuronate;
UDP-δ-glucuronic acid;
Uridine diphospho-δ-glucuronic acid;
Uridine pyrophosphoglucuronic acid
Formula: C15H22N2O18P2
Class: Endogenous Metabolites
Uridine 5'-diphosphoglucuronic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 302 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 12:51:45 PM |
| InChI | InChI=1S/C15H22N2O18P2/c18-5-1-2-17(15(26)16-5)12-9(22)6(19)4(32-12)3-31-36(27,28)35-37(29,30)34-14-10(23)7(20)8(21)11(33-14)13(24)25/h1-2,4,6-12,14,19-23H,3H2,(H,24,25)(H,27,28)(H,29,30)(H,16,18,26)/t4-,6-,7+,8+,9-,10-,11+,12-,14-/m1/s1 |
| InChI Key | HDYANYHVCAPMJV-LXQIFKJMSA-N |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)C(=O)O)O)O)O)O)O |
| CAS | 2616640 |
| Splash | |
| Other Names |
UDP-α-δ-glucuronate; UDP-δ-glucuronic acid; Uridine diphospho-δ-glucuronic acid; Uridine pyrophosphoglucuronic acid |
| ChemSpider | 16522 |
| PubChem | 17473 |
| ChemIDPlus | 002616640; 016419286 |
| HMDb | HMDB00935 |
| ChEMBL | CHEMBL228057 |
| ChEBI | CHEBI:17200 |
| KEGG | C00167 |