Systematic / IUPAC Name: (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-yl trihydrogen diphosphate
ID: Reference1420
Other Names:
2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, trihydrogen pyrophosphate, (E,E)-;
Diphosphoric acid, mono(3,7,11-trimethyl-2,6,10-dodecatrienyl) ester, (E,E)-;
3,7,11-Trimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate;
(E,E)-Farnesyl pyrophosphate;
(2E,6E)-Farnesyl pyrophosphate
; more
Formula: C15H28O7P2
Class: Endogenous Metabolites
Farnesyl pyrophosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 248 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 1:56:32 PM |
| InChI | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+,15-11+ |
| InChI Key | VWFJDQUYCIWHTN-YFVJMOTDSA-N |
| Canonical SMILES | CC(=CCCC(=CCCC(=CCOP(=O)(O)OP(=O)(O)O)C)C)C |
| CAS | 13058043 |
| Splash | |
| Other Names |
2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, trihydrogen pyrophosphate, (E,E)-; Diphosphoric acid, mono(3,7,11-trimethyl-2,6,10-dodecatrienyl) ester, (E,E)-; 3,7,11-Trimethyldodeca-2,6,10-trien-1-yl trihydrogen diphosphate; (E,E)-Farnesyl pyrophosphate; (2E,6E)-Farnesyl pyrophosphate; trans,trans-Farnesyl diphosphate; (E,E)-Farnesyl diphosphate; (2E,6E)-Farnesol diphosphate; trans,trans-Farnesyl pyrophosphate |
| Wikipedia | Farnesyl pyrophosphate |
| PubChem | 445713 |
| ChemSpider | 393270 |
| ChEMBL | CHEMBL69330 |
| ChEBI | CHEBI:17407 |
| KEGG | C00448 |
| HMDb | HMDB00961; HMDB04201 |
| ChemIDPlus | 013058043; 000372974 |