Systematic / IUPAC Name: 1,2,5,6,9,10-Hexabromocyclododecane
ID: Reference1423
Other Names:
Cyclododecane, 1,2,5,6,9,10-hexabromo-;
HBCD
Formula: C12H18Br6
Class: Industrial Chemicals
1,2,5,6,9,10-Hexabromocyclododecane (HBCD) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 1:53:39 PM |
| InChI | InChI=1S/C12H18Br6/c13-7-1-2-8(14)10(16)5-6-12(18)11(17)4-3-9(7)15/h7-12H,1-6H2 |
| InChI Key | DEIGXXQKDWULML-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(C(CCC(C(CCC(C1Br)Br)Br)Br)Br)Br |
| CAS | 3194556 |
| Splash | |
| Other Names |
Cyclododecane, 1,2,5,6,9,10-hexabromo-; HBCD |
| Wikipedia | Hexabromocyclododecane |
| ChEMBL | CHEMBL375298 |
| ChemIDPlus | 003194556 |
| PubChem | 18529 |
| ChemSpider | 17499 |