Systematic / IUPAC Name: 9-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione
ID: Reference1429
Other Names:
1H-Purine-2,6-dione, 3,9-dihydro-9-β-D-ribofuranosyl-;
3,9-Dihydro-9-β-δ-ribofuranosyl-1H-purine-2,6-dione;
Xanthine riboside;
β-D-Ribofuranoside, xanthine-9;
Xanthine 9-β-D-ribofuranoside
Formula: C10H12N4O6
Class: Endogenous Metabolites
Xanthosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 849 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/24/2026 12:52:21 PM |
| InChI | InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3-,5-,6-,9-/m1/s1 |
| InChI Key | UBORTCNDUKBEOP-UUOKFMHZSA-N |
| Canonical SMILES | |
| CAS | 146805 |
| Splash | |
| Other Names |
1H-Purine-2,6-dione, 3,9-dihydro-9-β-D-ribofuranosyl-; 3,9-Dihydro-9-β-δ-ribofuranosyl-1H-purine-2,6-dione; Xanthine riboside; β-D-Ribofuranoside, xanthine-9; Xanthine 9-β-D-ribofuranoside; 9-β-δ-Ribofuranosylxanthine |
| ChEBI | CHEBI:18107 |
| ChemIDPlus | 000146805 |
| KEGG | C01762 |
| ChEMBL | CHEMBL402439 |
| Wikipedia | Xanthosine |
| HMDb | HMDB00299 |
| PubChem | 64959 |
| ChemSpider | 58484 |