Systematic / IUPAC Name: (17β)-Estra-1(10),2,4-triene-3,17-diyl disulfate
ID: Reference1431
Other Names: 17β-Estradiol-3,17-disulfate
Formula: C18H24O8S2
Class: Endogenous Metabolites
β-Estradiol 3,17-disulfate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 253 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 1:37:21 PM |
| InChI | InChI=1S/C18H24O8S2/c1-18-9-8-14-13-5-3-12(25-27(19,20)21)10-11(13)2-4-15(14)16(18)6-7-17(18)26-28(22,23)24/h3,5,10,14-17H,2,4,6-9H2,1H3,(H,19,20,21)(H,22,23,24)/t14-,15-,16+,17+,18+/m1/s1 |
| InChI Key | VPLAJGAMHNQZIY-ZBRFXRBCSA-N |
| Canonical SMILES | CC12CCC3C(C1CCC2OS(=O)(=O)O)CCC4=C3C=CC(=C4)OS(=O)(=O)O |
| CAS | 3233703 |
| Splash | |
| Other Names | 17β-Estradiol-3,17-disulfate |
| PubChem | 66430 |
| ChemSpider | 59803 |
| ChEMBL | CHEMBL1162492 |
| ChemIDPlus | 003233703 |
| HMDb | HMDB41620 |