Systematic / IUPAC Name: 3,5-Dihydroxybenzoic acid
ID: Reference145
Other Names:
Benzoic acid, 3,5-dihydroxy-;
3,5-Dihydroxy benzoic acid;
α-Resorcylic acid;
5-Carboxyresorcinol;
3,5-DHBA
Formula: C7H6O4
Class: Endogenous Metabolites
3,5-Dihydroxybenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 616 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/10/2014 8:18:05 AM |
| InChI | InChI=1S/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) |
| InChI Key | UYEMGAFJOZZIFP-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C=C(C=C1O)O)C(=O)O |
| CAS | 99105 |
| Splash | |
| Other Names |
Benzoic acid, 3,5-dihydroxy-; 3,5-Dihydroxy benzoic acid; α-Resorcylic acid; 5-Carboxyresorcinol; 3,5-DHBA |
| ChEMBL | CHEMBL95308 |
| ChemIDPlus | 000099105 |
| Wikipedia | 3,5-Dihydroxybenzoic acid |
| HMDb | HMDB13677 |
| ChEBI | CHEBI:39912 |
| ChemSpider | 7146 |
| PubChem | 7424 |