Systematic / IUPAC Name: N-Acetyl-D-alloisoleucine
ID: Reference1480
Other Names:
Acetyl-D-allo-isoleucine;
D-Alloisoleucine, N-acetyl-
Formula: C8H15NO3
Class: Endogenous Metabolites
N-Acetyl-D-alloisoleucine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 128 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 10:48:59 AM |
| InChI | InChI=1S/C8H15NO3/c1-4-5(2)7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t5-,7+/m0/s1 |
| InChI Key | JDTWZSUNGHMMJM-CAHLUQPWSA-N |
| Canonical SMILES | CCC(C)C(C(=O)O)NC(=O)C |
| CAS | 54831208 |
| Splash | |
| Other Names |
Acetyl-D-allo-isoleucine; D-Alloisoleucine, N-acetyl- |