Systematic / IUPAC Name: 4-Hydroxybutanoic acid
ID: Reference1486
Other Names:
Butanoic acid, 4-hydroxy-;
Υ-Hydroxybutyrate;
Butyric acid, 4-hydroxy-;
Xyrem;
Sodium oxybate
; more
Formula: C4H8O3
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Endogenous Metabolites
4-Hydroxybutyric acid (GHB) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 247 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2018 8:28:00 AM |
| InChI | InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7) |
| InChI Key | SJZRECIVHVDYJC-UHFFFAOYSA-N |
| Canonical SMILES | C(CC(=O)O)CO |
| CAS | 591811 |
| Splash | |
| Other Names |
Butanoic acid, 4-hydroxy-; Υ-Hydroxybutyrate; Butyric acid, 4-hydroxy-; Xyrem; Sodium oxybate; Oxybate; Sodium Υ-oxybutyrate |
| Wikipedia | Gamma-Hydroxybutyric acid |
| PubChem | 10413 |
| KEGG | C00989; C01991 |
| LipidsMAPs | LMFA01050006 |
| ChEMBL | CHEMBL1342 |
| ChEBI | CHEBI:30830 |
| ChemSpider | 9984 |
| HMDb | HMDB00710 |
| ChemIDPlus | 000502852; 000591811; 063255298; 001320612; 052352279 |