Systematic / IUPAC Name: (2E)-2-Pentenedioic acid
ID: Reference1490
Other Names:
1,3-Propenedicarboxylate;
1,3-Propenedicarboxylic acid;
1-Propene-1,3-dicarboxylate;
1-Propene-1,3-dicarboxylic acid;
trans-Glutaconic acid
; more
Formula: C5H6O4
Class: Endogenous Metabolites
Glutaconic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 47 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 9:59:41 AM |
| InChI | InChI=1S/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9)/b2-1+ |
| InChI Key | XVOUMQNXTGKGMA-OWOJBTEDSA-N |
| Canonical SMILES | C(C=CC(=O)O)C(=O)O |
| CAS | 1724023 |
| Splash | |
| Other Names |
1,3-Propenedicarboxylate; 1,3-Propenedicarboxylic acid; 1-Propene-1,3-dicarboxylate; 1-Propene-1,3-dicarboxylic acid; trans-Glutaconic acid; Pent-2-enedioic acid; trans-Glutaconate; (E)-Glutaconate; (E)-Glutaconic acid; Pent-2-ene-1,5-dioic acid; 2-Pentenedioic acid, (2E)- |
| ChemIDPlus | 001724023 |
| Wikipedia | Glutaconic acid |
| ChEMBL | CHEMBL557347 |
| ChemSpider | 4444138 |
| HMDb | HMDB00620 |
| PubChem | 5280498 |
| KEGG | C02214 |
| ChEBI | CHEBI:15670 |