Systematic / IUPAC Name: N-Chloro-4-methylbenzenesulfonamide
ID: Reference1491
Other Names:
p-Toluenesulfonamide, N-chloro- ;
Benzenesulfonamide, N-chloro-4-methyl- ;
N-Chloro-p-toluenesulfonamide
Formula: C7H8ClNO2S
Class: Pesticides/Herbicides
Chloramine T mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/25/2016 7:24:44 AM |
| InChI | InChI=1S/C7H8ClNO2S/c1-6-2-4-7(5-3-6)12(10,11)9-8/h2-5,9H,1H3 |
| InChI Key | NXTVQNIVUKXOIL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCl |
| CAS | 127651 |
| Splash | |
| Other Names |
p-Toluenesulfonamide, N-chloro- ; Benzenesulfonamide, N-chloro-4-methyl- ; N-Chloro-p-toluenesulfonamide |
| Wikipedia | Chloramine-T |
| ChemIDPlus | 000144865 |
| ChemSpider | 29119 |
| PubChem | 31388 |
| ChEBI | CHEBI:53782 |
| ChEMBL | CHEMBL1625750 |